* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC CEFTIOFUR |
| English Synonyms: | ZINC CEFTIOFUR |
| MDL Number.: | MFCD16877189 |
| H bond acceptor: | 12 |
| H bond donor: | 2 |
| Smile: | CO/N=C(/c1csc(n1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CSC(=O)c4ccco4)C(=O)[O-].CO/N=C(/c1csc(n1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CSC(=O)c4ccco4)C(=O)[O-].[Zn+2] |
| InChi: | InChI=1S/2C19H17N5O7S3.Zn/c2*1-30-23-11(9-7-34-19(20)21-9)14(25)22-12-15(26)24-13(17(27)28)8(5-32-16(12)24)6-33-18(29)10-3-2-4-31-10;/h2*2-4,7,12,16H,5-6H2,1H3,(H2,20,21)(H,22,25)(H,27,28);/q;;+2/p-2/b2*23-11-;/t2*12-,16-;/m11./s1 |
| InChiKey: | InChIKey=BSNTUAAWSYWENG-JCJGKKMRSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.