* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FERROUS METHIONINE |
| English Synonyms: | FERROUS METHIONINE |
| MDL Number.: | MFCD16877197 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CSCCC(C(=O)[O-])N.CSCCC(C(=O)[O-])N.[Fe+2] |
| InChi: | InChI=1S/2C5H11NO2S.Fe/c2*1-9-3-2-4(6)5(7)8;/h2*4H,2-3,6H2,1H3,(H,7,8);/q;;+2/p-2 |
| InChiKey: | InChIKey=ABZRVUOCIRACEB-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.