* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMOIMIDAZO[1,2-A]PYRIMIDINE |
| CAS: | 1251033-57-4 |
| English Synonyms: | 7-BROMOIMIDAZO[1,2-A]PYRIMIDINE |
| MDL Number.: | MFCD16877232 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cn2ccnc2nc1Br |
| InChi: | InChI=1S/C6H4BrN3/c7-5-1-3-10-4-2-8-6(10)9-5/h1-4H |
| InChiKey: | InChIKey=QNMPFHNDEOTXNR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.