* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-BROMO-5-(BROMOMETHYL)-1H-INDOLE |
CAS: | 1245649-27-7 |
English Synonyms: | 3-BROMO-5-(BROMOMETHYL)-1H-INDOLE |
MDL Number.: | MFCD16877253 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1CBr)c(c[nH]2)Br |
InChi: | InChI=1S/C9H7Br2N/c10-4-6-1-2-9-7(3-6)8(11)5-12-9/h1-3,5,12H,4H2 |
InChiKey: | InChIKey=OVKCCPSTLYJBBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.