* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL |
| CAS: | 948592-54-9 |
| English Synonyms: | 4-CHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL ; PHENOL, 4-CHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)- |
| MDL Number.: | MFCD16877431 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(ccc2Cl)O |
| InChi: | InChI=1S/C12H16BClO3/c1-11(2)12(3,4)17-13(16-11)9-7-8(15)5-6-10(9)14/h5-7,15H,1-4H3 |
| InChiKey: | InChIKey=MTZMRMZJCYVKSJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.