* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-BROMO-1H-PYRAZOLO[4,3-C]PYRIDIN-3-AMINE |
| CAS: | 900863-28-7 |
| English Synonyms: | 4-BROMO-1H-PYRAZOLO[4,3-C]PYRIDIN-3-AMINE |
| MDL Number.: | MFCD16877657 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cnc(c2c1[nH]nc2N)Br |
| InChi: | InChI=1S/C6H5BrN4/c7-5-4-3(1-2-9-5)10-11-6(4)8/h1-2H,(H3,8,10,11) |
| InChiKey: | InChIKey=OASNHFNYJHFLDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.