* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-ACETYL-3H-3-BENZAZEPINE |
CAS: | 830324-18-0 |
English Synonyms: | 3-ACETYL-3H-3-BENZAZEPINE ; 3H-3-BENZAZEPINE, 3-ACETYL- |
MDL Number.: | MFCD16877822 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)N1C=Cc2ccccc2C=C1 |
InChi: | InChI=1S/C12H11NO/c1-10(14)13-8-6-11-4-2-3-5-12(11)7-9-13/h2-9H,1H3 |
InChiKey: | InChIKey=PROXHQPHWMBVNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.