* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-FLUORO-3,4-DIHYDRO-2H-1-BENZOPYRAN-6-OL |
| CAS: | 839694-48-3 |
| English Synonyms: | 2H-1-BENZOPYRAN-6-OL, 7-FLUORO-3,4-DIHYDRO- ; 7-FLUORO-3,4-DIHYDRO-2H-1-BENZOPYRAN-6-OL |
| MDL Number.: | MFCD16877845 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c2c(cc(c1O)F)OCCC2 |
| InChi: | InChI=1S/C9H9FO2/c10-7-5-9-6(4-8(7)11)2-1-3-12-9/h4-5,11H,1-3H2 |
| InChiKey: | InChIKey=ZBCPSLCUBDPAOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.