* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-DIOXOLANE, 2-[3-(1-CYCLOPROPEN-1-YL)PROPYL]- |
CAS: | 847862-60-6 |
English Synonyms: | 1,3-DIOXOLANE, 2-[3-(1-CYCLOPROPEN-1-YL)PROPYL]- ; 2-[3-(1-CYCLOPROPEN-1-YL)PROPYL]-1,3-DIOXOLANE |
MDL Number.: | MFCD16877885 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1COC(O1)CCCC2=CC2 |
InChi: | InChI=1S/C9H14O2/c1(2-8-4-5-8)3-9-10-6-7-11-9/h4,9H,1-3,5-7H2 |
InChiKey: | InChIKey=GMWYKXCFYOULDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.