* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENOL, 2,6-DICHLORO-, MONOHYDRATE |
| CAS: | 848169-95-9 |
| English Synonyms: | PHENOL, 2,6-DICHLORO-, MONOHYDRATE |
| MDL Number.: | MFCD16877894 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc(c(c(c1)Cl)O)Cl.O |
| InChi: | InChI=1S/C6H4Cl2O.H2O/c7-4-2-1-3-5(8)6(4)9;/h1-3,9H;1H2 |
| InChiKey: | InChIKey=UNBGRCJPTFUYFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.