* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-IMIDAZOLE, 5-(1,2,3,4,5,6-HEXAHYDRO-1-PENTALENYL)- |
CAS: | 849642-83-7 |
English Synonyms: | 1H-IMIDAZOLE, 5-(1,2,3,4,5,6-HEXAHYDRO-1-PENTALENYL)- ; 5-(1,2,3,4,5,6-HEXAHYDROPENTALEN-1-YL)-1H-IMIDAZOLE ; 5-(1,2,3,4,5,6-HEXAHYDRO-1-PENTALENYL)-1H-IMIDAZOLE |
MDL Number.: | MFCD16877919 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c([nH]cn1)C2CCC3=C2CCC3 |
InChi: | InChI=1S/C11H14N2/c1-2-8-4-5-10(9(8)3-1)11-6-12-7-13-11/h6-7,10H,1-5H2,(H,12,13) |
InChiKey: | InChIKey=GMOJQIPXFOCGMR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.