* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-4,5-DIHYDRO-9H-PURIN-2-AMINE |
CAS: | 851212-98-1 |
English Synonyms: | 9H-PURIN-2-AMINE, 6-CHLORO-4,5-DIHYDRO- ; 6-CHLORO-4,5-DIHYDRO-9H-PURIN-2-AMINE |
MDL Number.: | MFCD16877957 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C1=NC2C(N1)N=C(N=C2Cl)N |
InChi: | InChI=1S/C5H6ClN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1-2,4H,(H2,7,11)(H,8,9) |
InChiKey: | InChIKey=BBHXWJORXNTJIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.