* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[1,2-A]PYRAZINE-3,6(5H,7H)-DIONE |
CAS: | 851431-68-0 |
English Synonyms: | IMIDAZO[1,2-A]PYRAZINE-3,6(5H,7H)-DIONE |
MDL Number.: | MFCD16877966 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C1C(=O)NC=C2N1C(=O)C=N2 |
InChi: | InChI=1S/C6H5N3O2/c10-5-3-9-4(1-8-5)7-2-6(9)11/h1-2H,3H2,(H,8,10) |
InChiKey: | InChIKey=GKKGHAKOPZWHBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.