* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-IMIDAZO[4,5-F][1,4]OXAZEPINE |
CAS: | 851851-73-5 |
English Synonyms: | 1H-IMIDAZO[4,5-F][1,4]OXAZEPINE |
MDL Number.: | MFCD16877972 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1[nH]c2c(n1)OC=CN=C2 |
InChi: | InChI=1S/C6H5N3O/c1-2-10-6-5(3-7-1)8-4-9-6/h1-4H,(H,8,9) |
InChiKey: | InChIKey=SLPLKCUBZDKFQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.