* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1160021 |
English Synonyms: | FCHGROUP FCH1160021 |
MDL Number.: | MFCD16878034 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | C(=O)c1[nH]c(=O)[nH]c(=N)n1 |
InChi: | InChI=1S/C4H4N4O2/c5-3-6-2(1-9)7-4(10)8-3/h1H,(H3,5,6,7,8,10) |
InChiKey: | InChIKey=VOJZUPQWRUUKOA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.