* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-ACETYL-8-OXA-3-AZABICYCLO[3.2.1]OCTANE |
CAS: | 856176-68-6 |
English Synonyms: | 8-OXA-3-AZABICYCLO[3.2.1]OCTANE, 3-ACETYL- ; 3-ACETYL-8-OXA-3-AZABICYCLO[3.2.1]OCTANE |
MDL Number.: | MFCD16878140 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(=O)N1C[C@H]2CC[C@@H](C1)O2 |
InChi: | InChI=1S/C8H13NO2/c1-6(10)9-4-7-2-3-8(5-9)11-7/h7-8H,2-5H2,1H3/t7-,8+ |
InChiKey: | InChIKey=WYEHOCMBUGGXCD-OCAPTIKFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.