* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-OXABICYCLO[4.1.0]HEPTA-2,4-DIENE-2-CARBONITRILE |
| CAS: | 857633-15-9 |
| English Synonyms: | 7-OXABICYCLO[4.1.0]HEPTA-2,4-DIENE-2-CARBONITRILE |
| MDL Number.: | MFCD16878264 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C12C(=CC=CC2O1)C#N |
| InChi: | InChI=1S/C7H5NO/c8-4-5-2-1-3-6-7(5)9-6/h1-3,6-7H |
| InChiKey: | InChIKey=GNFQBKOLHDJZIP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.