* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIAZOLO[4,5-C]PYRIDIN-2-OL |
CAS: | 857970-39-9 |
English Synonyms: | THIAZOLO[4,5-C]PYRIDIN-2-OL ; [1,3]THIAZOLO[4,5-C]PYRIDIN-2-OL |
MDL Number.: | MFCD16878302 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cncc2c1sc(n2)O |
InChi: | InChI=1S/C6H4N2OS/c9-6-8-4-3-7-2-1-5(4)10-6/h1-3H,(H,8,9) |
InChiKey: | InChIKey=JHQMMHCYMPQTRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.