* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2H-PYRAZOLO[3,4-B]QUINOXALINE |
CAS: | 863637-42-7 |
English Synonyms: | 2H-PYRAZOLO[3,4-B]QUINOXALINE |
MDL Number.: | MFCD16878540 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)nc3c[nH]nc3n2 |
InChi: | InChI=1S/C9H6N4/c1-2-4-7-6(3-1)11-8-5-10-13-9(8)12-7/h1-5H,(H,10,12,13) |
InChiKey: | InChIKey=APDMFICDKLFJJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.