* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8H-FURO[3,2-G]INDOLE |
CAS: | 863994-90-5 |
English Synonyms: | 8H-FURO[3,2-G]INDOLE |
MDL Number.: | MFCD16878552 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc2ccoc2c3c1cc[nH]3 |
InChi: | InChI=1S/C10H7NO/c1-2-8-4-6-12-10(8)9-7(1)3-5-11-9/h1-6,11H |
InChiKey: | InChIKey=BSPXWOWUDWKJLV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.