* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROLO[2,3-B]PYRROLE-1,2,3(6H)-TRIAMINE |
| CAS: | 877396-86-6 |
| English Synonyms: | PYRROLO[2,3-B]PYRROLE-1,2,3(6H)-TRIAMINE |
| MDL Number.: | MFCD16878891 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | c1c[nH]c2c1c(c(n2N)N)N |
| InChi: | InChI=1S/C6H9N5/c7-4-3-1-2-10-6(3)11(9)5(4)8/h1-2,10H,7-9H2 |
| InChiKey: | InChIKey=KAYVTDDTSQGNJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.