* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (1H-PYRAZOLO[3,4-B]PYRIDIN-3-YL)METHANOL |
CAS: | 1211589-17-1 |
English Synonyms: | (1H-PYRAZOLO[3,4-B]PYRIDIN-3-YL)METHANOL ; ABBYPHARMA AP-31-2144 |
MDL Number.: | MFCD16987560 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(n[nH]c2nc1)CO |
InChi: | InChI=1S/C7H7N3O/c11-4-6-5-2-1-3-8-7(5)10-9-6/h1-3,11H,4H2,(H,8,9,10) |
InChiKey: | InChIKey=BSOPGFRGAWQHGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.