* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHOXY-2-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE |
| English Synonyms: | 7-METHOXY-2-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE |
| MDL Number.: | MFCD16987582 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cc1nc2cc(ccn2n1)OC |
| InChi: | InChI=1S/C8H9N3O/c1-6-9-8-5-7(12-2)3-4-11(8)10-6/h3-5H,1-2H3 |
| InChiKey: | InChIKey=FUWWYRKJGKTOBS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.