* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-FLUOROQUINOLIN-2(1H)-ONE |
| CAS: | 148136-14-5 |
| English Synonyms: | 7-FLUOROQUINOLIN-2(1H)-ONE ; 7-FLUORO-2(1H)-QUINOLINONE |
| MDL Number.: | MFCD16987608 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(cc2c1ccc(=O)[nH]2)F |
| InChi: | InChI=1S/C9H6FNO/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1-5H,(H,11,12) |
| InChiKey: | InChIKey=IPFWGOPYTUCFDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.