* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-FLUORO-6-PHENYL-PYRIMIDIN-4-OL |
| English Synonyms: | 5-FLUORO-6-PHENYL-PYRIMIDIN-4-OL |
| MDL Number.: | MFCD16987885 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2c(c(ncn2)O)F |
| InChi: | InChI=1S/C10H7FN2O/c11-8-9(12-6-13-10(8)14)7-4-2-1-3-5-7/h1-6H,(H,12,13,14) |
| InChiKey: | InChIKey=OAEXGHYHZANLDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.