* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1118 |
English Synonyms: | ABBYPHARMA AP-10-1118 |
MDL Number.: | MFCD16987897 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c(cnc(n1)CN)Br.Cl |
InChi: | InChI=1S/C5H6BrN3.ClH/c6-4-2-8-5(1-7)9-3-4;/h2-3H,1,7H2;1H |
InChiKey: | InChIKey=VSMRUKYRRGAGJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.