* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-2(1H)-PYRIMIDINONE |
| CAS: | 80927-55-5 |
| English Synonyms: | ABLOCK AB-14-2777 ; 6-CHLORO-2(1H)-PYRIMIDINONE |
| MDL Number.: | MFCD16987910 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cnc(=O)[nH]c1Cl |
| InChi: | InChI=1S/C4H3ClN2O/c5-3-1-2-6-4(8)7-3/h1-2H,(H,6,7,8) |
| InChiKey: | InChIKey=KVHNGYWHLLJFNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.