* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-1170 |
| English Synonyms: | ABBYPHARMA AP-10-1170 |
| MDL Number.: | MFCD16987912 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)c2c(c(nc(n2)O)O)F |
| InChi: | InChI=1S/C10H7FN2O2/c11-7-8(6-4-2-1-3-5-6)12-10(15)13-9(7)14/h1-5H,(H2,12,13,14,15) |
| InChiKey: | InChIKey=OAKRMXBNROJNHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.