* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-1220 |
| English Synonyms: | ABBYPHARMA AP-10-1220 |
| MDL Number.: | MFCD16987941 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)c1cnc(nc1Cl)CNC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C13H18ClN3O4/c1-5-20-11(18)8-6-15-9(17-10(8)14)7-16-12(19)21-13(2,3)4/h6H,5,7H2,1-4H3,(H,16,19) |
| InChiKey: | InChIKey=QAVZSKANDODPHE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.