* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-10-1236 |
English Synonyms: | ABBYPHARMA AP-10-1236 |
MDL Number.: | MFCD16987950 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)NCc1ncc(c(n1)Cl)C(=O)O |
InChi: | InChI=1S/C11H14ClN3O4/c1-11(2,3)19-10(18)14-5-7-13-4-6(9(16)17)8(12)15-7/h4H,5H2,1-3H3,(H,14,18)(H,16,17) |
InChiKey: | InChIKey=BIJBDYGWFFIYAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.