* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1378 |
English Synonyms: | ABBYPHARMA AP-10-1378 |
MDL Number.: | MFCD16988042 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cc(nc(n1)CNC(=O)OC(C)(C)C)C(=O)O |
InChi: | InChI=1S/C12H17N3O4/c1-7-5-8(10(16)17)15-9(14-7)6-13-11(18)19-12(2,3)4/h5H,6H2,1-4H3,(H,13,18)(H,16,17) |
InChiKey: | InChIKey=AOKUHPAGZQPCEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.