* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1383 |
CAS: | 885685-74-5 |
English Synonyms: | ABBYPHARMA AP-10-1383 |
MDL Number.: | MFCD16988047 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC1=NC(=S)NC(=C1)C(O)=O |
InChi: | InChI=1S/C6H6N2O2S/c1-3-2-4(5(9)10)8-6(11)7-3/h2H,1H3,(H,9,10)(H,7,8,11) |
InChiKey: | InChIKey=NNYBAMUGDCOIAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.