* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1505 |
CAS: | 23945-50-8 |
English Synonyms: | ABBYPHARMA AP-10-1505 |
MDL Number.: | MFCD16988100 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | OC(=O)C1=CNC(=S)N=C1O |
InChi: | InChI=1S/C5H4N2O3S/c8-3-2(4(9)10)1-6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) |
InChiKey: | InChIKey=XKHWTDCFQVKNHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.