* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1522 |
CAS: | 1542-23-0 |
English Synonyms: | ABBYPHARMA AP-10-1522 |
MDL Number.: | MFCD16988107 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | FC1=CN=C(S)NC1=O |
InChi: | InChI=1S/C4H3FN2OS/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
InChiKey: | InChIKey=AAMXUTIFBMEJAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.