* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-FLUORO-2-(FURAN-2-YL)PYRIMIDIN-4-OL |
| English Synonyms: | ABBYPHARMA AP-10-1530 ; 5-FLUORO-2-(FURAN-2-YL)PYRIMIDIN-4-OL |
| MDL Number.: | MFCD16988114 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(oc1)c2ncc(c(n2)O)F |
| InChi: | InChI=1S/C8H5FN2O2/c9-5-4-10-7(11-8(5)12)6-2-1-3-13-6/h1-4H,(H,10,11,12) |
| InChiKey: | InChIKey=UDXVQYZNZDXDNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.