* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1554 |
English Synonyms: | ABBYPHARMA AP-10-1554 |
MDL Number.: | MFCD16988129 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=CC(=O)NC(OC)=N1 |
InChi: | InChI=1S/C8H10N2O4/c1-3-14-7(12)5-4-6(11)10-8(9-5)13-2/h4H,3H2,1-2H3,(H,9,10,11) |
InChiKey: | InChIKey=ODIYCQGGTMPHAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.