* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1585 |
English Synonyms: | ABBYPHARMA AP-10-1585 |
MDL Number.: | MFCD16988150 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | OCC1=NC(=CC(=O)N1)C(O)=O |
InChi: | InChI=1S/C6H6N2O4/c9-2-4-7-3(6(11)12)1-5(10)8-4/h1,9H,2H2,(H,11,12)(H,7,8,10) |
InChiKey: | InChIKey=YGDIJXDPMFBDEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.