* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1588 |
CAS: | 84660-06-0 |
English Synonyms: | ABBYPHARMA AP-10-1588 |
MDL Number.: | MFCD16988152 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccnc(c1)c2[nH]c(=O)cc(n2)C(=O)O |
InChi: | InChI=1S/C10H7N3O3/c14-8-5-7(10(15)16)12-9(13-8)6-3-1-2-4-11-6/h1-5H,(H,15,16)(H,12,13,14) |
InChiKey: | InChIKey=VZAHIDKEGSCWOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.