* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1645 |
CAS: | 311340-94-0 |
English Synonyms: | ABBYPHARMA AP-10-1645 |
MDL Number.: | MFCD16988176 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1cnc(nc1c2ccccc2)CO |
InChi: | InChI=1S/C14H14N2O3/c1-2-19-14(18)11-8-15-12(9-17)16-13(11)10-6-4-3-5-7-10/h3-8,17H,2,9H2,1H3 |
InChiKey: | InChIKey=FCLBIOSTHJQZGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.