* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-1421 |
English Synonyms: | ABBYPHARMA AP-12-1421 |
MDL Number.: | MFCD16988279 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cnccc1c2cc(nc(n2)N)O |
InChi: | InChI=1S/C9H8N4O/c10-9-12-7(5-8(14)13-9)6-1-3-11-4-2-6/h1-5H,(H3,10,12,13,14) |
InChiKey: | InChIKey=IOKLRUQDALYCPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.