* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-2335 |
English Synonyms: | ABBYPHARMA AP-11-2335 |
MDL Number.: | MFCD16988404 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cl.CNCC1=CC2=C(C=C1)N=CC=N2 |
InChi: | InChI=1S/C10H11N3.ClH/c1-11-7-8-2-3-9-10(6-8)13-5-4-12-9;/h2-6,11H,7H2,1H3;1H |
InChiKey: | InChIKey=JYSHDTJHOQWZNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.