* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-3-METHOXYPYRIDO[2,3-B]PYRAZINE |
| English Synonyms: | 7-BROMO-3-METHOXYPYRIDO[2,3-B]PYRAZINE ; ABBYPHARMA AP-14-10638 |
| MDL Number.: | MFCD16988415 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COc1cnc2cc(cnc2n1)Br |
| InChi: | InChI=1S/C8H6BrN3O/c1-13-7-4-10-6-2-5(9)3-11-8(6)12-7/h2-4H,1H3 |
| InChiKey: | InChIKey=BJIVWEIQHXMTKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.