* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-16-10564 |
English Synonyms: | ABBYPHARMA AP-16-10564 |
MDL Number.: | MFCD16988418 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(nc2c1nc(cn2)C(F)(F)F)Br |
InChi: | InChI=1S/C8H3BrF3N3/c9-6-2-1-4-7(15-6)13-3-5(14-4)8(10,11)12/h1-3H |
InChiKey: | InChIKey=YTXXFFAGUIIYNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.