Molecular Structure:
CCD No.:CCD03260138
OTAVA-BB 3994376
Formula:C6 H3 Br N2 S
MolWeight:215.074
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3994376 |
| English Synonyms： | OTAVA-BB 3994376 |
| MDL Number.： | MFCD16988420 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | c1cnc2c(n1)cc(s2)Br |
| InChi： | InChI=1S/C6H3BrN2S/c7-5-3-4-6(10-5)9-2-1-8-4/h1-3H |
| InChiKey： | InChIKey=SHXIRKBNXDZQAU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
