* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-2383 |
English Synonyms: | ABBYPHARMA AP-11-2383 |
MDL Number.: | MFCD16988428 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cl.NC1=NC2=CC=C(Br)C=C2N=C1O |
InChi: | InChI=1S/C8H6BrN3O.ClH/c9-4-1-2-5-6(3-4)12-8(13)7(10)11-5;/h1-3H,(H2,10,11)(H,12,13);1H |
InChiKey: | InChIKey=JRVGMLUDGKZKBW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.