* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-2384 |
English Synonyms: | ABBYPHARMA AP-11-2384 |
MDL Number.: | MFCD16988429 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | BrC1=NC2=C(NCCO2)N=C1 |
InChi: | InChI=1S/C6H6BrN3O/c7-4-3-9-5-6(10-4)11-2-1-8-5/h3H,1-2H2,(H,8,9) |
InChiKey: | InChIKey=QEBQRDOZDNQNNM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.