* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-2388 |
English Synonyms: | ABBYPHARMA AP-11-2388 |
MDL Number.: | MFCD16988432 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | ClC1=CN=C(C#C)C(Cl)=N1 |
InChi: | InChI=1S/C6H2Cl2N2/c1-2-4-6(8)10-5(7)3-9-4/h1,3H |
InChiKey: | InChIKey=SIZLXZFITNZVMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.