* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-2694 |
English Synonyms: | ABBYPHARMA AP-11-2694 |
MDL Number.: | MFCD16988459 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)=CC1=NC=CN=C1N |
InChi: | InChI=1S/C8H11N3/c1-6(2)5-7-8(9)11-4-3-10-7/h3-5H,1-2H3,(H2,9,11) |
InChiKey: | InChIKey=WZVWNNCCMDNCKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.