* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-3308 |
English Synonyms: | ABBYPHARMA AP-10-3308 |
MDL Number.: | MFCD16988461 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cl.ClC1=CC=C(N=N1)C1CCNCC1 |
InChi: | InChI=1S/C9H12ClN3.ClH/c10-9-2-1-8(12-13-9)7-3-5-11-6-4-7;/h1-2,7,11H,3-6H2;1H |
InChiKey: | InChIKey=IAYDPUDTLWRDLS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.