* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-5875 |
| English Synonyms: | ABBYPHARMA AP-10-5875 |
| MDL Number.: | MFCD16988529 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)COc2cccc(n2)NN |
| InChi: | InChI=1S/C12H13N3O/c13-15-11-7-4-8-12(14-11)16-9-10-5-2-1-3-6-10/h1-8H,9,13H2,(H,14,15) |
| InChiKey: | InChIKey=VWENZYIHNJHRRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.